C31H29ClN6O4 — CID 90304267
3-amino-2-[[3-chloro-4-[2-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]ethynyl]benzoyl]-(2-methylpropyl)amino]propanoic acid (PubChem CID 90304267) has the molecular formula C31H29ClN6O4 and a molecular weight of 585.06 g/mol. Its IUPAC name is 3-amino-2-[[3-chloro-4-[2-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]ethynyl]benzoyl]-(2-methylpropyl)amino]propanoic acid.
| Compound Name | 3-amino-2-[[3-chloro-4-[2-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]ethynyl]benzoyl]-(2-methylpropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 90304267 |
| Molecular Formula | C31H29ClN6O4 |
| Molecular Weight | 585.06 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | 3-amino-2-[[3-chloro-4-[2-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]ethynyl]benzoyl]-(2-methylpropyl)amino]propanoic acid |
| SMILES | CC(C)CN(C(=O)c1ccc(C#Cc2ccc(-c3cc(C(=O)NN)c4cnccc4n3)cc2)c(Cl)c1)C(CN)C(=O)O |
| InChI | InChI=1S/C31H29ClN6O4/c1-18(2)17-38(28(15-33)31(41)42)30(40)22-10-9-20(25(32)13-22)6-3-19-4-7-21(8-5-19)27-14-23(29(39)37-34)24-16-35-12-11-26(24)36-27/h4-5,7-14,16,18,28H,15,17,33-34H2,1-2H3,(H,37,39)(H,41,42) |
| InChIKey | YRYVDSKOCZRHON-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 164.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.06 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|