C32H33N5O7 — CID 144674831
ethyl 2-[4-[2-[4-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]-1,6-naphthyridin-2-yl]phenyl]ethynyl]-2-oxo-1-pyridinyl]acetate;methanol (PubChem CID 144674831) has the molecular formula C32H33N5O7 and a molecular weight of 599.64 g/mol. Its IUPAC name is ethyl 2-[4-[2-[4-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]-1,6-naphthyridin-2-yl]phenyl]ethynyl]-2-oxo-1-pyridinyl]acetate;methanol.
| Compound Name | ethyl 2-[4-[2-[4-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]-1,6-naphthyridin-2-yl]phenyl]ethynyl]-2-oxo-1-pyridinyl]acetate;methanol |
|---|---|
| PubChem CID | 144674831 |
| Molecular Formula | C32H33N5O7 |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | ethyl 2-[4-[2-[4-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]-1,6-naphthyridin-2-yl]phenyl]ethynyl]-2-oxo-1-pyridinyl]acetate;methanol |
| SMILES | CCOC(=O)Cn1ccc(C#Cc2ccc(-c3cc(C(=O)NNC(=O)OC(C)(C)C)c4cnccc4n3)cc2)cc1=O.CO |
| InChI | InChI=1S/C31H29N5O6.CH4O/c1-5-41-28(38)19-36-15-13-21(16-27(36)37)7-6-20-8-10-22(11-9-20)26-17-23(24-18-32-14-12-25(24)33-26)29(39)34-35-30(40)42-31(2,3)4;1-2/h8-18H,5,19H2,1-4H3,(H,34,39)(H,35,40);2H,1H3 |
| InChIKey | HGIVKQZIXLGLIU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 161.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|