C24H15FN2O — CID 144675061
2-[4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl]-1,6-naphthyridine-4-carbaldehyde (PubChem CID 144675061) has the molecular formula C24H15FN2O and a molecular weight of 366.40 g/mol. Its IUPAC name is 2-[4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl]-1,6-naphthyridine-4-carbaldehyde.
| Compound Name | 2-[4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl]-1,6-naphthyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 144675061 |
| Molecular Formula | C24H15FN2O |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[4-[2-(2-fluoro-4-methylphenyl)ethynyl]phenyl]-1,6-naphthyridine-4-carbaldehyde |
| SMILES | Cc1ccc(C#Cc2ccc(-c3cc(C=O)c4cnccc4n3)cc2)c(F)c1 |
| InChI | InChI=1S/C24H15FN2O/c1-16-2-6-18(22(25)12-16)7-3-17-4-8-19(9-5-17)24-13-20(15-28)21-14-26-11-10-23(21)27-24/h2,4-6,8-15H,1H3 |
| InChIKey | PDHTYAUHNVAKHQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|