C40H44N2Si4 — CID 59467669
trimethyl-[2-[4,15,22-tris(2-trimethylsilylethynyl)-7,18-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3,5(10),6,8,11,13,15,17,19,21-undecaen-11-yl]ethynyl]silane (PubChem CID 59467669) has the molecular formula C40H44N2Si4 and a molecular weight of 665.15 g/mol. Its IUPAC name is trimethyl-[2-[4,15,22-tris(2-trimethylsilylethynyl)-7,18-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3,5(10),6,8,11,13,15,17,19,21-undecaen-11-yl]ethynyl]silane.
| Compound Name | trimethyl-[2-[4,15,22-tris(2-trimethylsilylethynyl)-7,18-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3,5(10),6,8,11,13,15,17,19,21-undecaen-11-yl]ethynyl]silane |
|---|---|
| PubChem CID | 59467669 |
| Molecular Formula | C40H44N2Si4 |
| Molecular Weight | 665.15 g/mol |
| Exact Mass | 664.26 |
| IUPAC Name | trimethyl-[2-[4,15,22-tris(2-trimethylsilylethynyl)-7,18-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3,5(10),6,8,11,13,15,17,19,21-undecaen-11-yl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1c2ccncc2c(C#C[Si](C)(C)C)c2cc3c(C#C[Si](C)(C)C)c4ccncc4c(C#C[Si](C)(C)C)c3cc12 |
| InChI | InChI=1S/C40H44N2Si4/c1-43(2,3)21-15-31-29-13-19-41-27-39(29)33(17-23-45(7,8)9)37-26-36-32(16-22-44(4,5)6)30-14-20-42-28-40(30)34(18-24-46(10,11)12)38(36)25-35(31)37/h13-14,19-20,25-28H,1-12H3 |
| InChIKey | IEPSIOVDPQWNSC-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.15 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|