C42H34N5O5P — CID 161018641
[methyl(phenoxy)phosphoryl]oxybenzene;2-phenyl-1,7-naphthyridin-4-amine;2-phenyl-1,7-naphthyridine-4-carboxylic acid (PubChem CID 161018641) has the molecular formula C42H34N5O5P and a molecular weight of 719.74 g/mol. Its IUPAC name is [methyl(phenoxy)phosphoryl]oxybenzene;2-phenyl-1,7-naphthyridin-4-amine;2-phenyl-1,7-naphthyridine-4-carboxylic acid.
| Compound Name | [methyl(phenoxy)phosphoryl]oxybenzene;2-phenyl-1,7-naphthyridin-4-amine;2-phenyl-1,7-naphthyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 161018641 |
| Molecular Formula | C42H34N5O5P |
| Molecular Weight | 719.74 g/mol |
| Exact Mass | 719.23 |
| IUPAC Name | [methyl(phenoxy)phosphoryl]oxybenzene;2-phenyl-1,7-naphthyridin-4-amine;2-phenyl-1,7-naphthyridine-4-carboxylic acid |
| SMILES | CP(=O)(Oc1ccccc1)Oc1ccccc1.Nc1cc(-c2ccccc2)nc2cnccc12.O=C(O)c1cc(-c2ccccc2)nc2cnccc12 |
| InChI | InChI=1S/C15H10N2O2.C14H11N3.C13H13O3P/c18-15(19)12-8-13(10-4-2-1-3-5-10)17-14-9-16-7-6-11(12)14;15-12-8-13(10-4-2-1-3-5-10)17-14-9-16-7-6-11(12)14;1-17(14,15-12-8-4-2-5-9-12)16-13-10-6-3-7-11-13/h1-9H,(H,18,19);1-9H,(H2,15,17);2-11H,1H3 |
| InChIKey | TYBHELSALCHSAV-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 150.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.74 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|