C21H20ClNO2 — CID 46779387
6,8-dimethyl-2-(3-propoxyphenyl)quinoline-4-carbonyl chloride (PubChem CID 46779387) has the molecular formula C21H20ClNO2 and a molecular weight of 353.85 g/mol. Its IUPAC name is 6,8-dimethyl-2-(3-propoxyphenyl)quinoline-4-carbonyl chloride.
| Compound Name | 6,8-dimethyl-2-(3-propoxyphenyl)quinoline-4-carbonyl chloride |
|---|---|
| PubChem CID | 46779387 |
| Molecular Formula | C21H20ClNO2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 6,8-dimethyl-2-(3-propoxyphenyl)quinoline-4-carbonyl chloride |
| SMILES | CCCOc1cccc(-c2cc(C(=O)Cl)c3cc(C)cc(C)c3n2)c1 |
| InChI | InChI=1S/C21H20ClNO2/c1-4-8-25-16-7-5-6-15(11-16)19-12-18(21(22)24)17-10-13(2)9-14(3)20(17)23-19/h5-7,9-12H,4,8H2,1-3H3 |
| InChIKey | QNRLYXFYXQPCBI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|