C26H20N2OS — CID 17260002
6,8-dimethyl-N-naphthalen-1-yl-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 17260002) has the molecular formula C26H20N2OS and a molecular weight of 408.53 g/mol. Its IUPAC name is 6,8-dimethyl-N-naphthalen-1-yl-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | 6,8-dimethyl-N-naphthalen-1-yl-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 17260002 |
| Molecular Formula | C26H20N2OS |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 6,8-dimethyl-N-naphthalen-1-yl-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | Cc1cc(C)c2nc(-c3cccs3)cc(C(=O)Nc3cccc4ccccc34)c2c1 |
| InChI | InChI=1S/C26H20N2OS/c1-16-13-17(2)25-20(14-16)21(15-23(27-25)24-11-6-12-30-24)26(29)28-22-10-5-8-18-7-3-4-9-19(18)22/h3-15H,1-2H3,(H,28,29) |
| InChIKey | SXJOONBWJIVLIX-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |