C16H19ClN2O2 — CID 103825258
2-chloro-N-(4-hydroxy-2,2-dimethylbutyl)quinoline-4-carboxamide (PubChem CID 103825258) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is 2-chloro-N-(4-hydroxy-2,2-dimethylbutyl)quinoline-4-carboxamide.
| Compound Name | 2-chloro-N-(4-hydroxy-2,2-dimethylbutyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 103825258 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-chloro-N-(4-hydroxy-2,2-dimethylbutyl)quinoline-4-carboxamide |
| SMILES | CC(C)(CCO)CNC(=O)c1cc(Cl)nc2ccccc12 |
| InChI | InChI=1S/C16H19ClN2O2/c1-16(2,7-8-20)10-18-15(21)12-9-14(17)19-13-6-4-3-5-11(12)13/h3-6,9,20H,7-8,10H2,1-2H3,(H,18,21) |
| InChIKey | CGUWZPRTWAVFOJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|