C29H20F6N2O3 — CID 87152451
4-nitro-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 87152451) has the molecular formula C29H20F6N2O3 and a molecular weight of 558.48 g/mol. Its IUPAC name is 4-nitro-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 4-nitro-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 87152451 |
| Molecular Formula | C29H20F6N2O3 |
| Molecular Weight | 558.48 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | 4-nitro-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | O=C(NC(Cc1ccccc1)(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H20F6N2O3/c30-28(31,32)23-10-4-8-21(16-23)27(18-19-6-2-1-3-7-19,22-9-5-11-24(17-22)29(33,34)35)36-26(38)20-12-14-25(15-13-20)37(39)40/h1-17H,18H2,(H,36,38) |
| InChIKey | SBGWMSZRSBUDJX-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.48 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|