C27H23F5N2O — CID 143473029
N-[(Z)-3-(ethylideneamino)-1-phenyl-2-[3-(trifluoromethyl)phenyl]pent-3-en-2-yl]-2,3-difluorobenzamide (PubChem CID 143473029) has the molecular formula C27H23F5N2O and a molecular weight of 486.48 g/mol. Its IUPAC name is N-[(Z)-3-(ethylideneamino)-1-phenyl-2-[3-(trifluoromethyl)phenyl]pent-3-en-2-yl]-2,3-difluorobenzamide.
| Compound Name | N-[(Z)-3-(ethylideneamino)-1-phenyl-2-[3-(trifluoromethyl)phenyl]pent-3-en-2-yl]-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 143473029 |
| Molecular Formula | C27H23F5N2O |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | N-[(Z)-3-(ethylideneamino)-1-phenyl-2-[3-(trifluoromethyl)phenyl]pent-3-en-2-yl]-2,3-difluorobenzamide |
| SMILES | C/C=N\C(=C/C)C(Cc1ccccc1)(NC(=O)c1cccc(F)c1F)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H23F5N2O/c1-3-23(33-4-2)26(17-18-10-6-5-7-11-18,19-12-8-13-20(16-19)27(30,31)32)34-25(35)21-14-9-15-22(28)24(21)29/h3-16H,17H2,1-2H3,(H,34,35)/b23-3-,33-4- |
| InChIKey | USUFGANFUSWVNZ-JBIWQLMVSA-N |
| XLogP | 6.85 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|