C29H19ClF7NO3 — CID 59458504
3-chloro-2-fluoro-N-[2-phenyl-1,1-bis[3-(trifluoromethoxy)phenyl]ethyl]benzamide (PubChem CID 59458504) has the molecular formula C29H19ClF7NO3 and a molecular weight of 597.91 g/mol. Its IUPAC name is 3-chloro-2-fluoro-N-[2-phenyl-1,1-bis[3-(trifluoromethoxy)phenyl]ethyl]benzamide.
| Compound Name | 3-chloro-2-fluoro-N-[2-phenyl-1,1-bis[3-(trifluoromethoxy)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 59458504 |
| Molecular Formula | C29H19ClF7NO3 |
| Molecular Weight | 597.91 g/mol |
| Exact Mass | 597.09 |
| IUPAC Name | 3-chloro-2-fluoro-N-[2-phenyl-1,1-bis[3-(trifluoromethoxy)phenyl]ethyl]benzamide |
| SMILES | O=C(NC(Cc1ccccc1)(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1)c1cccc(Cl)c1F |
| InChI | InChI=1S/C29H19ClF7NO3/c30-24-14-6-13-23(25(24)31)26(39)38-27(17-18-7-2-1-3-8-18,19-9-4-11-21(15-19)40-28(32,33)34)20-10-5-12-22(16-20)41-29(35,36)37/h1-16H,17H2,(H,38,39) |
| InChIKey | OJMAHHLRPOGCMT-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.91 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |