C36H29F10NO5 — CID 59458722
6-[4-[2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]-2,2-bis[3-(trifluoromethoxy)phenyl]ethyl]phenyl]hexanoic acid (PubChem CID 59458722) has the molecular formula C36H29F10NO5 and a molecular weight of 745.61 g/mol. Its IUPAC name is 6-[4-[2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]-2,2-bis[3-(trifluoromethoxy)phenyl]ethyl]phenyl]hexanoic acid.
| Compound Name | 6-[4-[2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]-2,2-bis[3-(trifluoromethoxy)phenyl]ethyl]phenyl]hexanoic acid |
|---|---|
| PubChem CID | 59458722 |
| Molecular Formula | C36H29F10NO5 |
| Molecular Weight | 745.61 g/mol |
| Exact Mass | 745.19 |
| IUPAC Name | 6-[4-[2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]-2,2-bis[3-(trifluoromethoxy)phenyl]ethyl]phenyl]hexanoic acid |
| SMILES | O=C(O)CCCCCc1ccc(CC(NC(=O)c2ccc(F)c(C(F)(F)F)c2)(c2cccc(OC(F)(F)F)c2)c2cccc(OC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C36H29F10NO5/c37-30-17-16-24(18-29(30)34(38,39)40)32(50)47-33(25-7-4-9-27(19-25)51-35(41,42)43,26-8-5-10-28(20-26)52-36(44,45)46)21-23-14-12-22(13-15-23)6-2-1-3-11-31(48)49/h4-5,7-10,12-20H,1-3,6,11,21H2,(H,47,50)(H,48,49) |
| InChIKey | IVXQSAPGSAQKEL-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.61 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|