C25H17F10N5O3 — CID 173497704
N-[3-diazenyl-3-hydrazinylidene-1,1-bis[3-(trifluoromethoxy)phenyl]propyl]-4-fluoro-3-(trifluoromethyl)benzamide (PubChem CID 173497704) has the molecular formula C25H17F10N5O3 and a molecular weight of 625.42 g/mol. Its IUPAC name is N-[3-diazenyl-3-hydrazinylidene-1,1-bis[3-(trifluoromethoxy)phenyl]propyl]-4-fluoro-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-diazenyl-3-hydrazinylidene-1,1-bis[3-(trifluoromethoxy)phenyl]propyl]-4-fluoro-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 173497704 |
| Molecular Formula | C25H17F10N5O3 |
| Molecular Weight | 625.42 g/mol |
| Exact Mass | 625.12 |
| IUPAC Name | N-[3-diazenyl-3-hydrazinylidene-1,1-bis[3-(trifluoromethoxy)phenyl]propyl]-4-fluoro-3-(trifluoromethyl)benzamide |
| SMILES | [H]/N=N/C(CC(NC(=O)c1ccc(F)c(C(F)(F)F)c1)(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1)=NN |
| InChI | InChI=1S/C25H17F10N5O3/c26-19-8-7-13(9-18(19)23(27,28)29)21(41)38-22(12-20(39-36)40-37,14-3-1-5-16(10-14)42-24(30,31)32)15-4-2-6-17(11-15)43-25(33,34)35/h1-11,36H,12,37H2,(H,38,41)/b39-36+,40-20? |
| InChIKey | ASNPHDBPCIZSEM-WWHTYHQSSA-N |
| XLogP | 7.01 |
| TPSA | 122.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.42 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|