C26H23F4IN4O4 — CID 89347631
1-[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-[(4R)-3-oxo-1,2-oxazolidin-4-yl]urea (PubChem CID 89347631) has the molecular formula C26H23F4IN4O4 and a molecular weight of 658.39 g/mol. Its IUPAC name is 1-[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-[(4R)-3-oxo-1,2-oxazolidin-4-yl]urea.
| Compound Name | 1-[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-[(4R)-3-oxo-1,2-oxazolidin-4-yl]urea |
|---|---|
| PubChem CID | 89347631 |
| Molecular Formula | C26H23F4IN4O4 |
| Molecular Weight | 658.39 g/mol |
| Exact Mass | 658.07 |
| IUPAC Name | 1-[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-2-phenyl-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-3-[(4R)-3-oxo-1,2-oxazolidin-4-yl]urea |
| SMILES | O=C(N[C@@H]1CONC1=O)N[C@@](Cc1ccccc1)(c1cccc(OC(F)(F)C(F)F)c1)c1ccc(CI)cn1 |
| InChI | InChI=1S/C26H23F4IN4O4/c27-23(28)26(29,30)39-19-8-4-7-18(11-19)25(12-16-5-2-1-3-6-16,21-10-9-17(13-31)14-32-21)34-24(37)33-20-15-38-35-22(20)36/h1-11,14,20,23H,12-13,15H2,(H,35,36)(H2,33,34,37)/t20-,25+/m1/s1 |
| InChIKey | KYHXQDYAYLNYNY-NLFFAJNJSA-N |
| XLogP | 4.47 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|