C29H28F9NO3 — CID 87152247
4,4,4-trifluoro-1-[[(1R)-1-(4-fluoro-3-propan-2-yloxyphenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]amino]butan-2-ol (PubChem CID 87152247) has the molecular formula C29H28F9NO3 and a molecular weight of 609.53 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[[(1R)-1-(4-fluoro-3-propan-2-yloxyphenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]amino]butan-2-ol.
| Compound Name | 4,4,4-trifluoro-1-[[(1R)-1-(4-fluoro-3-propan-2-yloxyphenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]amino]butan-2-ol |
|---|---|
| PubChem CID | 87152247 |
| Molecular Formula | C29H28F9NO3 |
| Molecular Weight | 609.53 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | 4,4,4-trifluoro-1-[[(1R)-1-(4-fluoro-3-propan-2-yloxyphenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]amino]butan-2-ol |
| SMILES | CC(C)Oc1cc([C@@](Cc2ccccc2)(NCC(O)CC(F)(F)F)c2cc(F)cc(OC(F)(F)C(F)F)c2)ccc1F |
| InChI | InChI=1S/C29H28F9NO3/c1-17(2)41-25-12-19(8-9-24(25)31)27(14-18-6-4-3-5-7-18,39-16-22(40)15-28(34,35)36)20-10-21(30)13-23(11-20)42-29(37,38)26(32)33/h3-13,17,22,26,39-40H,14-16H2,1-2H3/t22?,27-/m1/s1 |
| InChIKey | NLHDRCOQUOAVMY-RZIURPKCSA-N |
| XLogP | 7.38 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.53 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|