C31H29F8N3O4 — CID 87152041
4,4-difluoro-1-N-[(1R)-1-(4-fluoro-3-propan-2-yloxyphenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]pyrrolidine-1,2-dicarboxamide (PubChem CID 87152041) has the molecular formula C31H29F8N3O4 and a molecular weight of 659.57 g/mol. Its IUPAC name is 4,4-difluoro-1-N-[(1R)-1-(4-fluoro-3-propan-2-yloxyphenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]pyrrolidine-1,2-dicarboxamide.
| Compound Name | 4,4-difluoro-1-N-[(1R)-1-(4-fluoro-3-propan-2-yloxyphenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87152041 |
| Molecular Formula | C31H29F8N3O4 |
| Molecular Weight | 659.57 g/mol |
| Exact Mass | 659.20 |
| IUPAC Name | 4,4-difluoro-1-N-[(1R)-1-(4-fluoro-3-propan-2-yloxyphenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]pyrrolidine-1,2-dicarboxamide |
| SMILES | CC(C)Oc1cc([C@@](Cc2ccccc2)(NC(=O)N2CC(F)(F)CC2C(N)=O)c2cc(F)cc(OC(F)(F)C(F)F)c2)ccc1F |
| InChI | InChI=1S/C31H29F8N3O4/c1-17(2)45-25-12-19(8-9-23(25)33)30(14-18-6-4-3-5-7-18,41-28(44)42-16-29(36,37)15-24(42)26(40)43)20-10-21(32)13-22(11-20)46-31(38,39)27(34)35/h3-13,17,24,27H,14-16H2,1-2H3,(H2,40,43)(H,41,44)/t24?,30-/m1/s1 |
| InChIKey | JQDODNIVSINVIX-BXFARTRRSA-N |
| XLogP | 6.38 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.57 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|