C27H27ClF5N3O2 — CID 89112093
propyl N-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-N'-ethylcarbamimidate (PubChem CID 89112093) has the molecular formula C27H27ClF5N3O2 and a molecular weight of 555.98 g/mol. Its IUPAC name is propyl N-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-N'-ethylcarbamimidate.
| Compound Name | propyl N-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-N'-ethylcarbamimidate |
|---|---|
| PubChem CID | 89112093 |
| Molecular Formula | C27H27ClF5N3O2 |
| Molecular Weight | 555.98 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | propyl N-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-N'-ethylcarbamimidate |
| SMILES | CCCO/C(=N\CC)N[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C27H27ClF5N3O2/c1-3-12-37-25(34-4-2)36-26(16-18-8-6-5-7-9-18,23-11-10-20(28)17-35-23)19-13-21(29)15-22(14-19)38-27(32,33)24(30)31/h5-11,13-15,17,24H,3-4,12,16H2,1-2H3,(H,34,36)/t26-/m0/s1 |
| InChIKey | GFRFKONFEDTJPD-SANMLTNESA-N |
| XLogP | 6.99 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.98 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|