C23H19F6NO2 — CID 59192639
3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propan-1-amine (PubChem CID 59192639) has the molecular formula C23H19F6NO2 and a molecular weight of 455.40 g/mol. Its IUPAC name is 3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propan-1-amine.
| Compound Name | 3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 59192639 |
| Molecular Formula | C23H19F6NO2 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propan-1-amine |
| SMILES | NCC(Cc1ccccc1)(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C23H19F6NO2/c24-22(25,26)31-19-10-4-8-17(12-19)21(15-30,14-16-6-2-1-3-7-16)18-9-5-11-20(13-18)32-23(27,28)29/h1-13H,14-15,30H2 |
| InChIKey | HHXYIQJXNATWQJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |