C29H22F7NO2 — CID 59192957
3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline (PubChem CID 59192957) has the molecular formula C29H22F7NO2 and a molecular weight of 549.49 g/mol. Its IUPAC name is 3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline.
| Compound Name | 3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline |
|---|---|
| PubChem CID | 59192957 |
| Molecular Formula | C29H22F7NO2 |
| Molecular Weight | 549.49 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | 3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline |
| SMILES | Fc1cccc(NCC(Cc2ccccc2)(c2cccc(OC(F)(F)F)c2)c2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C29H22F7NO2/c30-23-11-6-12-24(17-23)37-19-27(18-20-7-2-1-3-8-20,21-9-4-13-25(15-21)38-28(31,32)33)22-10-5-14-26(16-22)39-29(34,35)36/h1-17,37H,18-19H2 |
| InChIKey | GGAPQCWVNXNQHU-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.49 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |