About 3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline
3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline (PubChem CID 59192957) has the molecular formula C29H22F7NO2
and a molecular weight of 549.49 g/mol. Its IUPAC name is 3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline.
Molecular Properties
| Compound Name | 3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline |
| PubChem CID | 59192957 |
| Molecular Formula | C29H22F7NO2 |
| Molecular Weight | 549.49 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | 3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline |
| SMILES | Fc1cccc(NCC(Cc2ccccc2)(c2cccc(OC(F)(F)F)c2)c2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C29H22F7NO2/c30-23-11-6-12-24(17-23)37-19-27(18-20-7-2-1-3-8-20,21-9-4-13-25(15-21)38-28(31,32)33)22-10-5-14-26(16-22)39-29(34,35)36/h1-17,37H,18-19H2 |
| InChIKey | GGAPQCWVNXNQHU-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 549.49 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline?
The IUPAC name of 3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline (CID 59192957) is 3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline.
What is the SMILES notation for 3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline?
The canonical SMILES for 3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline is Fc1cccc(NCC(Cc2ccccc2)(c2cccc(OC(F)(F)F)c2)c2cccc(OC(F)(F)F)c2)c1.
What is the InChIKey of 3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline?
The InChIKey is GGAPQCWVNXNQHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H22F7NO2/c30-23-11-6-12-24(17-23)37-19-27(18-20-7-2-1-3-8-20,21-9-4-13-25(15-21)38-28(31,32)33)22-10-5-14-26(16-22)39-29(34,35)36/h1-17,37H,18-19H2.
What are the key properties of 3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline?
3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline has a molecular weight of 549.49 g/mol, XLogP of 8.26, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]aniline is sourced from PubChem (CID 59192957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).