C27H27F6NO2 — CID 123725264
N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]butan-1-amine (PubChem CID 123725264) has the molecular formula C27H27F6NO2 and a molecular weight of 511.51 g/mol. Its IUPAC name is N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]butan-1-amine.
| Compound Name | N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]butan-1-amine |
|---|---|
| PubChem CID | 123725264 |
| Molecular Formula | C27H27F6NO2 |
| Molecular Weight | 511.51 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | N-[3-phenyl-2,2-bis[3-(trifluoromethoxy)phenyl]propyl]butan-1-amine |
| SMILES | CCCCNCC(Cc1ccccc1)(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C27H27F6NO2/c1-2-3-15-34-19-25(18-20-9-5-4-6-10-20,21-11-7-13-23(16-21)35-26(28,29)30)22-12-8-14-24(17-22)36-27(31,32)33/h4-14,16-17,34H,2-3,15,18-19H2,1H3 |
| InChIKey | IIFCEAZJNWUDOO-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.51 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|