C19H16F9NO3 — CID 87142058
5-amino-1,1,1-trifluoro-4,4-bis[3-(trifluoromethoxy)phenyl]pentan-2-ol (PubChem CID 87142058) has the molecular formula C19H16F9NO3 and a molecular weight of 477.32 g/mol. Its IUPAC name is 5-amino-1,1,1-trifluoro-4,4-bis[3-(trifluoromethoxy)phenyl]pentan-2-ol.
| Compound Name | 5-amino-1,1,1-trifluoro-4,4-bis[3-(trifluoromethoxy)phenyl]pentan-2-ol |
|---|---|
| PubChem CID | 87142058 |
| Molecular Formula | C19H16F9NO3 |
| Molecular Weight | 477.32 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 5-amino-1,1,1-trifluoro-4,4-bis[3-(trifluoromethoxy)phenyl]pentan-2-ol |
| SMILES | NCC(CC(O)C(F)(F)F)(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F9NO3/c20-17(21,22)15(30)9-16(10-29,11-3-1-5-13(7-11)31-18(23,24)25)12-4-2-6-14(8-12)32-19(26,27)28/h1-8,15,30H,9-10,29H2 |
| InChIKey | HIRRJXVLLVULSL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.32 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |