C17H22F3N5O2 — CID 118638837
N-[3-[[3-[[3-(trifluoromethoxy)phenyl]methylamino]prop-1-en-2-ylamino]diazenyl]propyl]prop-2-enamide (PubChem CID 118638837) has the molecular formula C17H22F3N5O2 and a molecular weight of 385.39 g/mol. Its IUPAC name is N-[3-[[3-[[3-(trifluoromethoxy)phenyl]methylamino]prop-1-en-2-ylamino]diazenyl]propyl]prop-2-enamide.
| Compound Name | N-[3-[[3-[[3-(trifluoromethoxy)phenyl]methylamino]prop-1-en-2-ylamino]diazenyl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 118638837 |
| Molecular Formula | C17H22F3N5O2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | N-[3-[[3-[[3-(trifluoromethoxy)phenyl]methylamino]prop-1-en-2-ylamino]diazenyl]propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCC/N=N/NC(=C)CNCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H22F3N5O2/c1-3-16(26)22-8-5-9-23-25-24-13(2)11-21-12-14-6-4-7-15(10-14)27-17(18,19)20/h3-4,6-7,10,21H,1-2,5,8-9,11-12H2,(H,22,26)(H,23,24) |
| InChIKey | JJEGAHLOLSUCKB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|