C13H12F3NO2 — CID 176540180
N-[2-[3-(trifluoromethoxy)phenyl]ethyl]buta-2,3-dienamide (PubChem CID 176540180) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is N-[2-[3-(trifluoromethoxy)phenyl]ethyl]buta-2,3-dienamide.
| Compound Name | N-[2-[3-(trifluoromethoxy)phenyl]ethyl]buta-2,3-dienamide |
|---|---|
| PubChem CID | 176540180 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-[2-[3-(trifluoromethoxy)phenyl]ethyl]buta-2,3-dienamide |
| SMILES | C=C=CC(=O)NCCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F3NO2/c1-2-4-12(18)17-8-7-10-5-3-6-11(9-10)19-13(14,15)16/h3-6,9H,1,7-8H2,(H,17,18) |
| InChIKey | AXYNNODEIBHVFR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|