C16H12BrF3INO2 — CID 53484423
2-bromo-3-iodo-N-[2-[3-(trifluoromethoxy)phenyl]ethyl]benzamide (PubChem CID 53484423) has the molecular formula C16H12BrF3INO2 and a molecular weight of 514.08 g/mol. Its IUPAC name is 2-bromo-3-iodo-N-[2-[3-(trifluoromethoxy)phenyl]ethyl]benzamide.
| Compound Name | 2-bromo-3-iodo-N-[2-[3-(trifluoromethoxy)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 53484423 |
| Molecular Formula | C16H12BrF3INO2 |
| Molecular Weight | 514.08 g/mol |
| Exact Mass | 512.90 |
| IUPAC Name | 2-bromo-3-iodo-N-[2-[3-(trifluoromethoxy)phenyl]ethyl]benzamide |
| SMILES | O=C(NCCc1cccc(OC(F)(F)F)c1)c1cccc(I)c1Br |
| InChI | InChI=1S/C16H12BrF3INO2/c17-14-12(5-2-6-13(14)21)15(23)22-8-7-10-3-1-4-11(9-10)24-16(18,19)20/h1-6,9H,7-8H2,(H,22,23) |
| InChIKey | QURYLCZAFWFJNN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.08 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|