C12H12FNO3S — CID 176540176
3-[2-(buta-2,3-dienoylamino)ethyl]benzenesulfonyl fluoride (PubChem CID 176540176) has the molecular formula C12H12FNO3S and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-[2-(buta-2,3-dienoylamino)ethyl]benzenesulfonyl fluoride.
| Compound Name | 3-[2-(buta-2,3-dienoylamino)ethyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 176540176 |
| Molecular Formula | C12H12FNO3S |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 3-[2-(buta-2,3-dienoylamino)ethyl]benzenesulfonyl fluoride |
| SMILES | C=C=CC(=O)NCCc1cccc(S(=O)(=O)F)c1 |
| InChI | InChI=1S/C12H12FNO3S/c1-2-4-12(15)14-8-7-10-5-3-6-11(9-10)18(13,16)17/h3-6,9H,1,7-8H2,(H,14,15) |
| InChIKey | IWPPMHFPAUWDBC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|