C18H15F4NO — CID 51135585
(Z)-4,4,4-trifluoro-N-[2-(3-fluorophenyl)ethyl]-3-phenylbut-2-enamide (PubChem CID 51135585) has the molecular formula C18H15F4NO and a molecular weight of 337.32 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-N-[2-(3-fluorophenyl)ethyl]-3-phenylbut-2-enamide.
| Compound Name | (Z)-4,4,4-trifluoro-N-[2-(3-fluorophenyl)ethyl]-3-phenylbut-2-enamide |
|---|---|
| PubChem CID | 51135585 |
| Molecular Formula | C18H15F4NO |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (Z)-4,4,4-trifluoro-N-[2-(3-fluorophenyl)ethyl]-3-phenylbut-2-enamide |
| SMILES | O=C(/C=C(/c1ccccc1)C(F)(F)F)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C18H15F4NO/c19-15-8-4-5-13(11-15)9-10-23-17(24)12-16(18(20,21)22)14-6-2-1-3-7-14/h1-8,11-12H,9-10H2,(H,23,24)/b16-12- |
| InChIKey | ZUGILZPHESNHEM-VBKFSLOCSA-N |
| XLogP | 4.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|