C21H18F3NO2 — CID 56507126
(E)-4,4,4-trifluoro-3-phenyl-N-[2-(4-prop-2-ynoxyphenyl)ethyl]but-2-enamide (PubChem CID 56507126) has the molecular formula C21H18F3NO2 and a molecular weight of 373.37 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-3-phenyl-N-[2-(4-prop-2-ynoxyphenyl)ethyl]but-2-enamide.
| Compound Name | (E)-4,4,4-trifluoro-3-phenyl-N-[2-(4-prop-2-ynoxyphenyl)ethyl]but-2-enamide |
|---|---|
| PubChem CID | 56507126 |
| Molecular Formula | C21H18F3NO2 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (E)-4,4,4-trifluoro-3-phenyl-N-[2-(4-prop-2-ynoxyphenyl)ethyl]but-2-enamide |
| SMILES | C#CCOc1ccc(CCNC(=O)/C=C(\c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18F3NO2/c1-2-14-27-18-10-8-16(9-11-18)12-13-25-20(26)15-19(21(22,23)24)17-6-4-3-5-7-17/h1,3-11,15H,12-14H2,(H,25,26)/b19-15+ |
| InChIKey | VAQRQCPURSXVBB-XDJHFCHBSA-N |
| XLogP | 4.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|