C26H26N2O3S — CID 86962670
1-[3-(benzylsulfinylmethyl)phenyl]-3-[2-(4-prop-2-ynoxyphenyl)ethyl]urea (PubChem CID 86962670) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is 1-[3-(benzylsulfinylmethyl)phenyl]-3-[2-(4-prop-2-ynoxyphenyl)ethyl]urea.
| Compound Name | 1-[3-(benzylsulfinylmethyl)phenyl]-3-[2-(4-prop-2-ynoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 86962670 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 1-[3-(benzylsulfinylmethyl)phenyl]-3-[2-(4-prop-2-ynoxyphenyl)ethyl]urea |
| SMILES | C#CCOc1ccc(CCNC(=O)Nc2cccc(CS(=O)Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C26H26N2O3S/c1-2-17-31-25-13-11-21(12-14-25)15-16-27-26(29)28-24-10-6-9-23(18-24)20-32(30)19-22-7-4-3-5-8-22/h1,3-14,18H,15-17,19-20H2,(H2,27,28,29) |
| InChIKey | IBJDVPZFDKILET-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|