C15H16F3N3O2 — CID 169150581
1-[[3-(cyanomethoxy)phenyl]methyl]-3-[3-(trifluoromethyl)but-3-enyl]urea (PubChem CID 169150581) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is 1-[[3-(cyanomethoxy)phenyl]methyl]-3-[3-(trifluoromethyl)but-3-enyl]urea.
| Compound Name | 1-[[3-(cyanomethoxy)phenyl]methyl]-3-[3-(trifluoromethyl)but-3-enyl]urea |
|---|---|
| PubChem CID | 169150581 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-[[3-(cyanomethoxy)phenyl]methyl]-3-[3-(trifluoromethyl)but-3-enyl]urea |
| SMILES | C=C(CCNC(=O)NCc1cccc(OCC#N)c1)C(F)(F)F |
| InChI | InChI=1S/C15H16F3N3O2/c1-11(15(16,17)18)5-7-20-14(22)21-10-12-3-2-4-13(9-12)23-8-6-19/h2-4,9H,1,5,7-8,10H2,(H2,20,21,22) |
| InChIKey | JDSXWLIWUBCDMS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|