C17H16F3N3O3 — CID 38260097
2-(benzylcarbamoylamino)-N-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 38260097) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is 2-(benzylcarbamoylamino)-N-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-(benzylcarbamoylamino)-N-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 38260097 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-(benzylcarbamoylamino)-N-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CNC(=O)NCc1ccccc1)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3N3O3/c18-17(19,20)26-14-8-4-7-13(9-14)23-15(24)11-22-16(25)21-10-12-5-2-1-3-6-12/h1-9H,10-11H2,(H,23,24)(H2,21,22,25) |
| InChIKey | XJPBYGWNRMBDNP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |