C20H16F3N3O3 — CID 122303779
N-(4,6-dimethyl-2-phenoxypyrimidin-5-yl)-3-(trifluoromethoxy)benzamide (PubChem CID 122303779) has the molecular formula C20H16F3N3O3 and a molecular weight of 403.36 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-phenoxypyrimidin-5-yl)-3-(trifluoromethoxy)benzamide.
| Compound Name | N-(4,6-dimethyl-2-phenoxypyrimidin-5-yl)-3-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 122303779 |
| Molecular Formula | C20H16F3N3O3 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-(4,6-dimethyl-2-phenoxypyrimidin-5-yl)-3-(trifluoromethoxy)benzamide |
| SMILES | Cc1nc(Oc2ccccc2)nc(C)c1NC(=O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F3N3O3/c1-12-17(13(2)25-19(24-12)28-15-8-4-3-5-9-15)26-18(27)14-7-6-10-16(11-14)29-20(21,22)23/h3-11H,1-2H3,(H,26,27) |
| InChIKey | RCVLWCMCSYUGCN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |