C19H24O4 — CID 140607843
(2E,4E)-5-cyclopentyl-1-(3,4,5-trimethoxyphenyl)penta-2,4-dien-1-one (PubChem CID 140607843) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (2E,4E)-5-cyclopentyl-1-(3,4,5-trimethoxyphenyl)penta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-cyclopentyl-1-(3,4,5-trimethoxyphenyl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 140607843 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (2E,4E)-5-cyclopentyl-1-(3,4,5-trimethoxyphenyl)penta-2,4-dien-1-one |
| SMILES | COc1cc(C(=O)/C=C/C=C/C2CCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C19H24O4/c1-21-17-12-15(13-18(22-2)19(17)23-3)16(20)11-7-6-10-14-8-4-5-9-14/h6-7,10-14H,4-5,8-9H2,1-3H3/b10-6+,11-7+ |
| InChIKey | CLQWXRCMWOHHJC-JMQWPVDRSA-N |
| XLogP | 4.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|