C28H30BrNO6 — CID 134378222
(Z)-3-[3-bromo-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]anilino]-1-(2-methoxyphenyl)prop-2-en-1-one (PubChem CID 134378222) has the molecular formula C28H30BrNO6 and a molecular weight of 556.45 g/mol. Its IUPAC name is (Z)-3-[3-bromo-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]anilino]-1-(2-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (Z)-3-[3-bromo-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]anilino]-1-(2-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 134378222 |
| Molecular Formula | C28H30BrNO6 |
| Molecular Weight | 556.45 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | (Z)-3-[3-bromo-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]anilino]-1-(2-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccccc1C(=O)/C=C\Nc1cc(CCc2cc(OC)c(OC)c(OC)c2)cc(Br)c1OC |
| InChI | InChI=1S/C28H30BrNO6/c1-32-24-9-7-6-8-20(24)23(31)12-13-30-22-15-18(14-21(29)27(22)35-4)10-11-19-16-25(33-2)28(36-5)26(17-19)34-3/h6-9,12-17,30H,10-11H2,1-5H3/b13-12- |
| InChIKey | KGENKABGFJURRH-SEYXRHQNSA-N |
| XLogP | 6.09 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.45 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|