C30H29BrN2O5 — CID 118495460
(Z)-3-[3-bromo-2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-(1-methylindol-3-yl)prop-2-en-1-one (PubChem CID 118495460) has the molecular formula C30H29BrN2O5 and a molecular weight of 577.48 g/mol. Its IUPAC name is (Z)-3-[3-bromo-2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-(1-methylindol-3-yl)prop-2-en-1-one.
| Compound Name | (Z)-3-[3-bromo-2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-(1-methylindol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 118495460 |
| Molecular Formula | C30H29BrN2O5 |
| Molecular Weight | 577.48 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | (Z)-3-[3-bromo-2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-(1-methylindol-3-yl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/c2cc(Br)c(OC)c(N/C=C\C(=O)c3cn(C)c4ccccc34)c2)cc(OC)c1OC |
| InChI | InChI=1S/C30H29BrN2O5/c1-33-18-22(21-8-6-7-9-25(21)33)26(34)12-13-32-24-15-19(14-23(31)29(24)37-4)10-11-20-16-27(35-2)30(38-5)28(17-20)36-3/h6-18,32H,1-5H3/b11-10+,13-12- |
| InChIKey | GZTHJRHVGABAKS-MRBUWEIXSA-N |
| XLogP | 6.95 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.48 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|