C28H29NO4 — CID 118509342
(Z)-1-(2-ethylphenyl)-3-[2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one (PubChem CID 118509342) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is (Z)-1-(2-ethylphenyl)-3-[2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one.
| Compound Name | (Z)-1-(2-ethylphenyl)-3-[2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one |
|---|---|
| PubChem CID | 118509342 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (Z)-1-(2-ethylphenyl)-3-[2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one |
| SMILES | CCc1ccccc1C(=O)/C=C\Nc1ccccc1/C=C\c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C28H29NO4/c1-5-21-10-6-8-12-23(21)25(30)16-17-29-24-13-9-7-11-22(24)15-14-20-18-26(31-2)28(33-4)27(19-20)32-3/h6-19,29H,5H2,1-4H3/b15-14-,17-16- |
| InChIKey | ZNYVIZLHJGCFOA-WHEHHYQMSA-N |
| XLogP | 6.25 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|