C28H28FNO5 — CID 118506959
(Z)-3-[3-fluoro-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-(4-methylphenyl)prop-2-en-1-one (PubChem CID 118506959) has the molecular formula C28H28FNO5 and a molecular weight of 477.53 g/mol. Its IUPAC name is (Z)-3-[3-fluoro-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | (Z)-3-[3-fluoro-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 118506959 |
| Molecular Formula | C28H28FNO5 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | (Z)-3-[3-fluoro-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-(4-methylphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C\c2cc(F)c(OC)c(N/C=C\C(=O)c3ccc(C)cc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C28H28FNO5/c1-18-6-10-21(11-7-18)24(31)12-13-30-23-15-19(14-22(29)27(23)34-4)8-9-20-16-25(32-2)28(35-5)26(17-20)33-3/h6-17,30H,1-5H3/b9-8-,13-12- |
| InChIKey | WGZPUMIMADAETJ-OZKAYXIQSA-N |
| XLogP | 6.15 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|