C28H25F4NO6 — CID 154201716
3-[3-fluoro-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 154201716) has the molecular formula C28H25F4NO6 and a molecular weight of 547.50 g/mol. Its IUPAC name is 3-[3-fluoro-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | 3-[3-fluoro-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 154201716 |
| Molecular Formula | C28H25F4NO6 |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | 3-[3-fluoro-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | COc1cc(C=Cc2cc(F)c(OC)c(NC=CC(=O)c3ccc(OC(F)(F)F)cc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C28H25F4NO6/c1-35-24-15-18(16-25(36-2)27(24)38-4)6-5-17-13-21(29)26(37-3)22(14-17)33-12-11-23(34)19-7-9-20(10-8-19)39-28(30,31)32/h5-16,33H,1-4H3 |
| InChIKey | ARYPDGDXBSMWGE-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|