C29H28F3NO7 — CID 118495317
(Z)-3-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 118495317) has the molecular formula C29H28F3NO7 and a molecular weight of 559.54 g/mol. Its IUPAC name is (Z)-3-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (Z)-3-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118495317 |
| Molecular Formula | C29H28F3NO7 |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | (Z)-3-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C\c2ccc(OC)c(OC)c2N/C=C\C(=O)c2ccc(OC(F)(F)F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H28F3NO7/c1-35-23-13-10-20(7-6-18-16-24(36-2)27(38-4)25(17-18)37-3)26(28(23)39-5)33-15-14-22(34)19-8-11-21(12-9-19)40-29(30,31)32/h6-17,33H,1-5H3/b7-6-,15-14- |
| InChIKey | HKRRGKYDYLUXLC-HXDWTSBLSA-N |
| XLogP | 6.61 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|