C29H32N2O7 — CID 118495306
(Z)-1-(3-amino-4-methoxyphenyl)-3-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one (PubChem CID 118495306) has the molecular formula C29H32N2O7 and a molecular weight of 520.58 g/mol. Its IUPAC name is (Z)-1-(3-amino-4-methoxyphenyl)-3-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one.
| Compound Name | (Z)-1-(3-amino-4-methoxyphenyl)-3-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one |
|---|---|
| PubChem CID | 118495306 |
| Molecular Formula | C29H32N2O7 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | (Z)-1-(3-amino-4-methoxyphenyl)-3-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C\Nc2c(/C=C\c3cc(OC)c(OC)c(OC)c3)ccc(OC)c2OC)cc1N |
| InChI | InChI=1S/C29H32N2O7/c1-33-23-11-10-20(17-21(23)30)22(32)13-14-31-27-19(9-12-24(34-2)29(27)38-6)8-7-18-15-25(35-3)28(37-5)26(16-18)36-4/h7-17,31H,30H2,1-6H3/b8-7-,14-13- |
| InChIKey | XIFCFRJPJYPYNO-WRKWTSPFSA-N |
| XLogP | 5.30 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|