C28H30N2O7 — CID 118500949
(Z)-1-(3-amino-4-methoxyphenyl)-3-[2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one (PubChem CID 118500949) has the molecular formula C28H30N2O7 and a molecular weight of 506.56 g/mol. Its IUPAC name is (Z)-1-(3-amino-4-methoxyphenyl)-3-[2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one.
| Compound Name | (Z)-1-(3-amino-4-methoxyphenyl)-3-[2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one |
|---|---|
| PubChem CID | 118500949 |
| Molecular Formula | C28H30N2O7 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | (Z)-1-(3-amino-4-methoxyphenyl)-3-[2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C\Nc2c(/C=C\c3cc(OC)c(OC)c(OC)c3)ccc(OC)c2O)cc1N |
| InChI | InChI=1S/C28H30N2O7/c1-33-22-10-9-19(16-20(22)29)21(31)12-13-30-26-18(8-11-23(34-2)27(26)32)7-6-17-14-24(35-3)28(37-5)25(15-17)36-4/h6-16,30,32H,29H2,1-5H3/b7-6-,13-12- |
| InChIKey | FVWHNOZPEOSNPJ-ASZCUJMBSA-N |
| XLogP | 5.00 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|