C27H25BrFNO8 — CID 134378275
(Z)-1-(2-bromo-4,5-dihydroxy-3-methoxyphenyl)-3-[3-fluoro-5-[(Z)-2-(3-hydroxy-4,5-dimethoxyphenyl)ethenyl]-2-methoxyanilino]prop-2-en-1-one (PubChem CID 134378275) has the molecular formula C27H25BrFNO8 and a molecular weight of 590.40 g/mol. Its IUPAC name is (Z)-1-(2-bromo-4,5-dihydroxy-3-methoxyphenyl)-3-[3-fluoro-5-[(Z)-2-(3-hydroxy-4,5-dimethoxyphenyl)ethenyl]-2-methoxyanilino]prop-2-en-1-one.
| Compound Name | (Z)-1-(2-bromo-4,5-dihydroxy-3-methoxyphenyl)-3-[3-fluoro-5-[(Z)-2-(3-hydroxy-4,5-dimethoxyphenyl)ethenyl]-2-methoxyanilino]prop-2-en-1-one |
|---|---|
| PubChem CID | 134378275 |
| Molecular Formula | C27H25BrFNO8 |
| Molecular Weight | 590.40 g/mol |
| Exact Mass | 589.07 |
| IUPAC Name | (Z)-1-(2-bromo-4,5-dihydroxy-3-methoxyphenyl)-3-[3-fluoro-5-[(Z)-2-(3-hydroxy-4,5-dimethoxyphenyl)ethenyl]-2-methoxyanilino]prop-2-en-1-one |
| SMILES | COc1cc(/C=C\c2cc(F)c(OC)c(N/C=C\C(=O)c3cc(O)c(O)c(OC)c3Br)c2)cc(O)c1OC |
| InChI | InChI=1S/C27H25BrFNO8/c1-35-22-12-15(11-21(33)26(22)37-3)6-5-14-9-17(29)25(36-2)18(10-14)30-8-7-19(31)16-13-20(32)24(34)27(38-4)23(16)28/h5-13,30,32-34H,1-4H3/b6-5-,8-7- |
| InChIKey | CINITHYBXAKAGI-ISTTXYCBSA-N |
| XLogP | 5.72 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.40 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|