C30H31BrFNO8 — CID 154210681
1-(2-bromo-3,4,5-trimethoxyphenyl)-3-[3-fluoro-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one (PubChem CID 154210681) has the molecular formula C30H31BrFNO8 and a molecular weight of 632.48 g/mol. Its IUPAC name is 1-(2-bromo-3,4,5-trimethoxyphenyl)-3-[3-fluoro-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one.
| Compound Name | 1-(2-bromo-3,4,5-trimethoxyphenyl)-3-[3-fluoro-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one |
|---|---|
| PubChem CID | 154210681 |
| Molecular Formula | C30H31BrFNO8 |
| Molecular Weight | 632.48 g/mol |
| Exact Mass | 631.12 |
| IUPAC Name | 1-(2-bromo-3,4,5-trimethoxyphenyl)-3-[3-fluoro-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one |
| SMILES | COc1cc(C=Cc2cc(F)c(OC)c(NC=CC(=O)c3cc(OC)c(OC)c(OC)c3Br)c2)cc(OC)c1OC |
| InChI | InChI=1S/C30H31BrFNO8/c1-35-23-14-18(15-24(36-2)28(23)39-5)9-8-17-12-20(32)27(38-4)21(13-17)33-11-10-22(34)19-16-25(37-3)29(40-6)30(41-7)26(19)31/h8-16,33H,1-7H3 |
| InChIKey | CKTIQPLNKMYRQH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.48 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|