C30H35NO8 — CID 134378250
1-(3,4-dimethoxyphenyl)-3-[4,5-dimethoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]propan-1-one (PubChem CID 134378250) has the molecular formula C30H35NO8 and a molecular weight of 537.61 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[4,5-dimethoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]propan-1-one.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[4,5-dimethoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]propan-1-one |
|---|---|
| PubChem CID | 134378250 |
| Molecular Formula | C30H35NO8 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[4,5-dimethoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]propan-1-one |
| SMILES | COc1ccc(C(=O)CCNc2cc(OC)c(OC)cc2/C=C\c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C30H35NO8/c1-33-24-11-10-21(17-25(24)34-2)23(32)12-13-31-22-18-27(36-4)26(35-3)16-20(22)9-8-19-14-28(37-5)30(39-7)29(15-19)38-6/h8-11,14-18,31H,12-13H2,1-7H3/b9-8- |
| InChIKey | IZEVQSKOAIBMBU-HJWRWDBZSA-N |
| XLogP | 5.60 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|