C26H29NO8S — CID 121314863
N-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-4-methoxybenzenesulfonamide (PubChem CID 121314863) has the molecular formula C26H29NO8S and a molecular weight of 515.58 g/mol. Its IUPAC name is N-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 121314863 |
| Molecular Formula | C26H29NO8S |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | N-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2c(/C=C\c3cc(OC)c(OC)c(OC)c3)ccc(OC)c2OC)cc1 |
| InChI | InChI=1S/C26H29NO8S/c1-30-19-10-12-20(13-11-19)36(28,29)27-24-18(9-14-21(31-2)26(24)35-6)8-7-17-15-22(32-3)25(34-5)23(16-17)33-4/h7-16,27H,1-6H3/b8-7- |
| InChIKey | VPFXZNAFYCNNQB-FPLPWBNLSA-N |
| XLogP | 4.71 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|