C25H26ClNO7S — CID 121314860
3-chloro-N-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide (PubChem CID 121314860) has the molecular formula C25H26ClNO7S and a molecular weight of 520.00 g/mol. Its IUPAC name is 3-chloro-N-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121314860 |
| Molecular Formula | C25H26ClNO7S |
| Molecular Weight | 520.00 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | 3-chloro-N-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide |
| SMILES | COc1cc(/C=C\c2ccc(OC)c(OC)c2NS(=O)(=O)c2cccc(Cl)c2)cc(OC)c1OC |
| InChI | InChI=1S/C25H26ClNO7S/c1-30-20-12-11-17(10-9-16-13-21(31-2)24(33-4)22(14-16)32-3)23(25(20)34-5)27-35(28,29)19-8-6-7-18(26)15-19/h6-15,27H,1-5H3/b10-9- |
| InChIKey | PTNHCOGZOFQDEU-KTKRTIGZSA-N |
| XLogP | 5.35 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.00 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|