C24H22F3NO5S — CID 121315059
3-(trifluoromethyl)-N-[3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide (PubChem CID 121315059) has the molecular formula C24H22F3NO5S and a molecular weight of 493.50 g/mol. Its IUPAC name is 3-(trifluoromethyl)-N-[3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide.
| Compound Name | 3-(trifluoromethyl)-N-[3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121315059 |
| Molecular Formula | C24H22F3NO5S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 3-(trifluoromethyl)-N-[3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide |
| SMILES | COc1cc(/C=C\c2cccc(NS(=O)(=O)c3cccc(C(F)(F)F)c3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H22F3NO5S/c1-31-21-13-17(14-22(32-2)23(21)33-3)11-10-16-6-4-8-19(12-16)28-34(29,30)20-9-5-7-18(15-20)24(25,26)27/h4-15,28H,1-3H3/b11-10- |
| InChIKey | HXOHIECOAXOSPW-KHPPLWFESA-N |
| XLogP | 5.70 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|