C25H25FO6S — CID 162078160
5-[(Z)-2-[2-[(3-fluoro-4-methoxyphenyl)sulfonylmethyl]phenyl]ethenyl]-1,2,3-trimethoxybenzene (PubChem CID 162078160) has the molecular formula C25H25FO6S and a molecular weight of 472.53 g/mol. Its IUPAC name is 5-[(Z)-2-[2-[(3-fluoro-4-methoxyphenyl)sulfonylmethyl]phenyl]ethenyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[(Z)-2-[2-[(3-fluoro-4-methoxyphenyl)sulfonylmethyl]phenyl]ethenyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 162078160 |
| Molecular Formula | C25H25FO6S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 5-[(Z)-2-[2-[(3-fluoro-4-methoxyphenyl)sulfonylmethyl]phenyl]ethenyl]-1,2,3-trimethoxybenzene |
| SMILES | COc1ccc(S(=O)(=O)Cc2ccccc2/C=C\c2cc(OC)c(OC)c(OC)c2)cc1F |
| InChI | InChI=1S/C25H25FO6S/c1-29-22-12-11-20(15-21(22)26)33(27,28)16-19-8-6-5-7-18(19)10-9-17-13-23(30-2)25(32-4)24(14-17)31-3/h5-15H,16H2,1-4H3/b10-9- |
| InChIKey | CGLXRAZXUIVJHK-KTKRTIGZSA-N |
| XLogP | 5.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|