C24H23NO7S — CID 158675988
1,2,3-trimethoxy-5-[(Z)-2-[2-[(4-nitrophenyl)sulfonylmethyl]phenyl]ethenyl]benzene (PubChem CID 158675988) has the molecular formula C24H23NO7S and a molecular weight of 469.52 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[(Z)-2-[2-[(4-nitrophenyl)sulfonylmethyl]phenyl]ethenyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[(Z)-2-[2-[(4-nitrophenyl)sulfonylmethyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 158675988 |
| Molecular Formula | C24H23NO7S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 1,2,3-trimethoxy-5-[(Z)-2-[2-[(4-nitrophenyl)sulfonylmethyl]phenyl]ethenyl]benzene |
| SMILES | COc1cc(/C=C\c2ccccc2CS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H23NO7S/c1-30-22-14-17(15-23(31-2)24(22)32-3)8-9-18-6-4-5-7-19(18)16-33(28,29)21-12-10-20(11-13-21)25(26)27/h4-15H,16H2,1-3H3/b9-8- |
| InChIKey | JNVXQUMXAQMWTJ-HJWRWDBZSA-N |
| XLogP | 4.76 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|