C29H30O8 — CID 159572554
(Z)-1-(3-hydroxy-4-methoxyphenyl)-4-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]but-2-en-1-one (PubChem CID 159572554) has the molecular formula C29H30O8 and a molecular weight of 506.55 g/mol. Its IUPAC name is (Z)-1-(3-hydroxy-4-methoxyphenyl)-4-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]but-2-en-1-one.
| Compound Name | (Z)-1-(3-hydroxy-4-methoxyphenyl)-4-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]but-2-en-1-one |
|---|---|
| PubChem CID | 159572554 |
| Molecular Formula | C29H30O8 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | (Z)-1-(3-hydroxy-4-methoxyphenyl)-4-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]but-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C\Cc2cc(OC)c(O)cc2/C=C\c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C29H30O8/c1-33-25-12-11-21(16-23(25)31)22(30)8-6-7-19-17-26(34-2)24(32)15-20(19)10-9-18-13-27(35-3)29(37-5)28(14-18)36-4/h6,8-17,31-32H,7H2,1-5H3/b8-6-,10-9- |
| InChIKey | OJAWZKCSNSVRQO-VAOAJWRNSA-N |
| XLogP | 5.29 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|