C27H26O5 — CID 159086560
(Z)-1-(4-hydroxyphenyl)-4-[2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]but-2-en-1-one (PubChem CID 159086560) has the molecular formula C27H26O5 and a molecular weight of 430.50 g/mol. Its IUPAC name is (Z)-1-(4-hydroxyphenyl)-4-[2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]but-2-en-1-one.
| Compound Name | (Z)-1-(4-hydroxyphenyl)-4-[2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]but-2-en-1-one |
|---|---|
| PubChem CID | 159086560 |
| Molecular Formula | C27H26O5 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (Z)-1-(4-hydroxyphenyl)-4-[2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]but-2-en-1-one |
| SMILES | COc1cc(/C=C\c2ccccc2C/C=C\C(=O)c2ccc(O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H26O5/c1-30-25-17-19(18-26(31-2)27(25)32-3)11-12-21-8-5-4-7-20(21)9-6-10-24(29)22-13-15-23(28)16-14-22/h4-8,10-18,28H,9H2,1-3H3/b10-6-,12-11- |
| InChIKey | RTDGDPKZRVNNPW-RCGVWGGBSA-N |
| XLogP | 5.57 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|